CAS 2241867-46-7 is the registry number for (5–(bis(methyl–d3)amino)pyridin–3–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-[bis(trideuteriomethyl)amino]-3-pyridinyl]boronic acid (CAS 2241867-46-7) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 172.02 g/mol. IUPAC name: [5-[bis(trideuteriomethyl)amino]-3-pyridinyl]boronic acid. InChIKey: XONOLKVBZTVRBK-WFGJKAKNSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 172.02 g/mol |
| IUPAC name | [5-[bis(trideuteriomethyl)amino]-3-pyridinyl]boronic acid |
| InChIKey | XONOLKVBZTVRBK-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C1=CN=CC(=C1)B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)