CAS 2241867-63-8 is the registry number for 2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)pyridine–6–d. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-deuterio-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2241867-63-8) is a chemical compound with the molecular formula C11H16BNO2 and a molecular weight of 206.07 g/mol. IUPAC name: 2-deuterio-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: SOQIDYYUSMPIDR-BNEYPBHNSA-N.
| Molecular formula | C11H16BNO2 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-deuterio-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | SOQIDYYUSMPIDR-BNEYPBHNSA-N |
| SMILES | [2H]C1=NC(=CC=C1)B2OC(C(O2)(C)C)(C)C |
Computed by PubChem (NCBI)