CAS 2241877-09-6 is the registry number for (4–(propan–2–yl–d7)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-5-yl]boronic acid (CAS 2241877-09-6) is a chemical compound with the molecular formula C7H11BN2O2 and a molecular weight of 173.03 g/mol. IUPAC name: [4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-5-yl]boronic acid. InChIKey: SMZXLPHORPDPKW-TXVPSQRDSA-N.
| Molecular formula | C7H11BN2O2 |
|---|---|
| Molecular weight | 173.03 g/mol |
| IUPAC name | [4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-5-yl]boronic acid |
| InChIKey | SMZXLPHORPDPKW-TXVPSQRDSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC=NC=C1B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)