CAS 2243-58-5 appears in our catalog under these names: 2-Naphthylhydrazine HCl, Naphthalen–2–ylhydrazine hydrochloride, 2-Naphthalenyl hydrazine hydrochloride, Naphthalen-2-ylhydrazine hydrochloride 95%, Naphthalen-2-ylhydrazine hydrochloride, 98%, 98%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100g, 500g, 0,025kg, 0,05kg, 0,1kg, 0,25kg, 0,5kg.
Naphthalen-2-ylhydrazine;hydrochloride (CAS 2243-58-5) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: naphthalen-2-ylhydrazine;hydrochloride. InChIKey: OXOQKRNEPBHINU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | naphthalen-2-ylhydrazine;hydrochloride |
| InChIKey | OXOQKRNEPBHINU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NN.Cl |
Computed by PubChem (NCBI)