Products 2243505-93-1

CAS 2243505-93-1 is the registry number for tert-Butyl N-{2-azaspiro(3.4)octan-5-yl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-azaspiro[3.4]octan-5-yl)carbamate (CAS 2243505-93-1) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-(2-azaspiro[3.4]octan-5-yl)carbamate. InChIKey: BAVZQYGRHJQYDC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O2
Molecular weight226.32 g/mol
IUPAC nametert-butyl N-(2-azaspiro[3.4]octan-5-yl)carbamate
InChIKeyBAVZQYGRHJQYDC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CCCC12CNC2

Computed by PubChem (NCBI)