CAS 2243508-75-8 is the registry number for rac-Methyl (4aR,7aS)-octahydro-1H-cyclopenta(b)pyridine-4a-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (4aS,7aR)-1,2,3,4,5,6,7,7a-octahydrocyclopenta[b]pyridine-4a-carboxylate (CAS 2243508-75-8) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: methyl (4aS,7aR)-1,2,3,4,5,6,7,7a-octahydrocyclopenta[b]pyridine-4a-carboxylate. InChIKey: QEBLUEAHTWJGPB-SCZZXKLOSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | methyl (4aS,7aR)-1,2,3,4,5,6,7,7a-octahydrocyclopenta[b]pyridine-4a-carboxylate |
| InChIKey | QEBLUEAHTWJGPB-SCZZXKLOSA-N |
| SMILES | COC(=O)[C@]12CCC[C@H]1NCCC2 |
Computed by PubChem (NCBI)