Products 2245708-25-0
CAS 2245708-25-0 is the registry number for 1,4-Diethyl 2,3-dihydroxy-1,4-benzenedicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Diethyl 2,3-dihydroxybenzene-1,4-dicarboxylate (CAS 2245708-25-0) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: diethyl 2,3-dihydroxybenzene-1,4-dicarboxylate. InChIKey: FYSWHLYJLYNRKF-UHFFFAOYSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | diethyl 2,3-dihydroxybenzene-1,4-dicarboxylate |
| InChIKey | FYSWHLYJLYNRKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1)C(=O)OCC)O)O |
Computed by PubChem (NCBI)
Synonyms:
diethyldihydroxy terephthalate