Products 2247105-92-4
CAS 2247105-92-4 is the registry number for 1,3-Di-tert-butyl 3-(prop-2-yn-1-yl)pyrrolidine-1,3-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ditert-butyl 3-prop-2-ynylpyrrolidine-1,3-dicarboxylate (CAS 2247105-92-4) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: ditert-butyl 3-prop-2-ynylpyrrolidine-1,3-dicarboxylate. InChIKey: MNQANYAYSBEWRY-UHFFFAOYSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | ditert-butyl 3-prop-2-ynylpyrrolidine-1,3-dicarboxylate |
| InChIKey | MNQANYAYSBEWRY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CCN(C1)C(=O)OC(C)(C)C)CC#C |
Computed by PubChem (NCBI)