CAS 2247690-40-8 is the registry number for 7-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 2247690-40-8) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 7-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: BTTYVPZBESYMPR-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 7-amino-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | BTTYVPZBESYMPR-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C=CC(=C2)N |
Computed by PubChem (NCBI)