Products 2247784-22-9
CAS 2247784-22-9 is the registry number for 5-(1,2,2-Triphenylvinyl)isophthalic acid, AR. Offered by: Fluorochem. Available pack sizes: 500mg, 1g.
5-(1,2,2-triphenylethenyl)benzene-1,3-dicarboxylic acid (CAS 2247784-22-9) is a chemical compound with the molecular formula C28H20O4 and a molecular weight of 420.5 g/mol. IUPAC name: 5-(1,2,2-triphenylethenyl)benzene-1,3-dicarboxylic acid. InChIKey: KWFKVHLLRHUNLU-UHFFFAOYSA-N.
| Molecular formula | C28H20O4 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 5-(1,2,2-triphenylethenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | KWFKVHLLRHUNLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC(=CC(=C3)C(=O)O)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)