Products 2248092-17-1
CAS 2248092-17-1 is the registry number for Ethyl (E)-3-(3-bromo-5-fluorophenyl)acrylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ethyl (E)-3-(3-bromo-5-fluorophenyl)prop-2-enoate (CAS 2248092-17-1) is a chemical compound with the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. IUPAC name: ethyl (E)-3-(3-bromo-5-fluorophenyl)prop-2-enoate. InChIKey: ROCIGXPFLFUVQK-ONEGZZNKSA-N.
| Molecular formula | C11H10BrFO2 |
|---|---|
| Molecular weight | 273.10 g/mol |
| IUPAC name | ethyl (E)-3-(3-bromo-5-fluorophenyl)prop-2-enoate |
| InChIKey | ROCIGXPFLFUVQK-ONEGZZNKSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)