CAS 2248176-08-9 appears in our catalog under these names: rel-(1s,3s)-3-((tert-Butoxycarbonyl)(methyl)amino)cyclobutane-1-carboxylic acid, 95%, (1s,3s)-3-((tert-Butoxycarbonyl)(methyl)amino)cyclobutane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid (CAS 2248176-08-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid. InChIKey: PHNDFCGTUWXBMI-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclobutane-1-carboxylic acid |
| InChIKey | PHNDFCGTUWXBMI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1CC(C1)C(=O)O |
Computed by PubChem (NCBI)