CAS 2248258-64-0 is the registry number for Methyl 2-amino-3-(quinolin-3-yl)propanoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-amino-3-quinolin-3-ylpropanoate;dihydrochloride (CAS 2248258-64-0) is a chemical compound with the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.18 g/mol. IUPAC name: methyl 2-amino-3-quinolin-3-ylpropanoate;dihydrochloride. InChIKey: ACXMWPACNDUQRY-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | methyl 2-amino-3-quinolin-3-ylpropanoate;dihydrochloride |
| InChIKey | ACXMWPACNDUQRY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC2=CC=CC=C2N=C1)N.Cl.Cl |
Computed by PubChem (NCBI)