CAS 2287316-43-0 is the registry number for Ethyl 2-(chloromethyl)-1-ethyl-1H-1,3-benzodiazole-5-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 2-(chloromethyl)-1-ethylbenzimidazole-5-carboxylate;hydrochloride (CAS 2287316-43-0) is a chemical compound with the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.18 g/mol. IUPAC name: ethyl 2-(chloromethyl)-1-ethylbenzimidazole-5-carboxylate;hydrochloride. InChIKey: PAUTYTKNKJAVMP-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | ethyl 2-(chloromethyl)-1-ethylbenzimidazole-5-carboxylate;hydrochloride |
| InChIKey | PAUTYTKNKJAVMP-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C(=O)OCC)N=C1CCl.Cl |
Computed by PubChem (NCBI)