Products 2829282-30-4
CAS 2829282-30-4 appears in our catalog under these names: (S)-Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate dihydrochloride, 97%, 97%, (S)-Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate dihydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;dihydrochloride (CAS 2829282-30-4) is a chemical compound with the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.18 g/mol. IUPAC name: methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;dihydrochloride. InChIKey: UPOONFLTGWNLSH-IDMXKUIJSA-N.
| Molecular formula | C13H16Cl2N2O2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;dihydrochloride |
| InChIKey | UPOONFLTGWNLSH-IDMXKUIJSA-N |
| SMILES | COC(=O)[C@@H]1CC2=C(CN1)NC3=CC=CC=C23.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-Tpi-ome dihydrochloride