CAS 27311-52-0 appears in our catalog under these names: Bis(5-amino-2-hydroxyphenyl)methan diHCl, 98%, 98%, 2,2'-Methylenebis(4-aminophenol) dihydrochloride, 98%, 2,2'-Methylenebis(4-aminophenol) dihydrochloride, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 1g.
4-amino-2-[(5-amino-2-hydroxyphenyl)methyl]phenol;dihydrochloride (CAS 27311-52-0) is a chemical compound with the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.18 g/mol. IUPAC name: 4-amino-2-[(5-amino-2-hydroxyphenyl)methyl]phenol;dihydrochloride. InChIKey: WKERZZAEPVPFPO-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2N2O2 |
|---|---|
| Molecular weight | 303.18 g/mol |
| IUPAC name | 4-amino-2-[(5-amino-2-hydroxyphenyl)methyl]phenol;dihydrochloride |
| InChIKey | WKERZZAEPVPFPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)CC2=C(C=CC(=C2)N)O)O.Cl.Cl |
Computed by PubChem (NCBI)