Products 2248350-08-3

CAS 2248350-08-3 is the registry number for tert-Butyl 2-((4-hydroxyphenyl)methyl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[(4-hydroxyphenyl)methyl]piperidine-1-carboxylate (CAS 2248350-08-3) is a chemical compound with the molecular formula C17H25NO3 and a molecular weight of 291.4 g/mol. IUPAC name: tert-butyl 2-[(4-hydroxyphenyl)methyl]piperidine-1-carboxylate. InChIKey: RFTRQNIFYHIYKX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H25NO3
Molecular weight291.4 g/mol
IUPAC nametert-butyl 2-[(4-hydroxyphenyl)methyl]piperidine-1-carboxylate
InChIKeyRFTRQNIFYHIYKX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC1CC2=CC=C(C=C2)O

Computed by PubChem (NCBI)