CAS 2248401-50-3 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3,3-difluoro-2-methylpropanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
3,3-difluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2248401-50-3) is a chemical compound with the molecular formula C9H15F2NO4 and a molecular weight of 239.22 g/mol. IUPAC name: 3,3-difluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VXRNTACBEWCPSU-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO4 |
|---|---|
| Molecular weight | 239.22 g/mol |
| IUPAC name | 3,3-difluoro-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VXRNTACBEWCPSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C(F)F)C(=O)O |
Computed by PubChem (NCBI)