Products 2248406-93-9
CAS 2248406-93-9 is the registry number for rac-Methyl (2R)-2-amino-2-((2R)-2,3-dihydro-1-benzofuran-2-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl (2S)-2-amino-2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]acetate;hydrochloride (CAS 2248406-93-9) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: methyl (2S)-2-amino-2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]acetate;hydrochloride. InChIKey: VMCFKYZBRPJVQN-IYPAPVHQSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-[(2S)-2,3-dihydro-1-benzofuran-2-yl]acetate;hydrochloride |
| InChIKey | VMCFKYZBRPJVQN-IYPAPVHQSA-N |
| SMILES | COC(=O)[C@H]([C@@H]1CC2=CC=CC=C2O1)N.Cl |
Computed by PubChem (NCBI)