CAS 2249005-28-3 is the registry number for Z3071585108. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]pyridazine-4-carbonitrile (CAS 2249005-28-3) is a chemical compound with the molecular formula C17H16N6 and a molecular weight of 304.3 g/mol. IUPAC name: 3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]pyridazine-4-carbonitrile. InChIKey: JVVLSCNLUICXDH-UHFFFAOYSA-N.
| Molecular formula | C17H16N6 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 3-[3-(1H-pyrrolo[2,3-b]pyridin-3-yl)piperidin-1-yl]pyridazine-4-carbonitrile |
| InChIKey | JVVLSCNLUICXDH-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=C(C=CN=N2)C#N)C3=CNC4=C3C=CC=N4 |
Computed by PubChem (NCBI)