CAS 380436-54-4 is the registry number for 1-{((1,3-diphenyl-1H-pyrazol-4-yl)methylidene)amino}guanidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine (CAS 380436-54-4) is a chemical compound with the molecular formula C17H16N6 and a molecular weight of 304.3 g/mol. IUPAC name: 2-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine. InChIKey: NMGWKCHTMNJLNC-RGVLZGJSSA-N.
| Molecular formula | C17H16N6 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]guanidine |
| InChIKey | NMGWKCHTMNJLNC-RGVLZGJSSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=C2/C=N/N=C(N)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)