CAS 750522-61-3 is the registry number for NSC309401. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[(4-aminophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine (CAS 750522-61-3) is a chemical compound with the molecular formula C17H16N6 and a molecular weight of 304.3 g/mol. IUPAC name: 7-[(4-aminophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine. InChIKey: LNEWNMFMWDBAKM-UHFFFAOYSA-N.
| Molecular formula | C17H16N6 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 7-[(4-aminophenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine |
| InChIKey | LNEWNMFMWDBAKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=CC3=C2C=CC4=C3C(=NC(=N4)N)N)N |
Computed by PubChem (NCBI)