Products 782479-66-7
CAS 782479-66-7 is the registry number for 1,1'-((5-(1H-Imidazol-1-yl)-1,3-phenylene)bis(methylene))bis(1H-imidazole), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3,5-bis(imidazol-1-ylmethyl)phenyl]imidazole (CAS 782479-66-7) is a chemical compound with the molecular formula C17H16N6 and a molecular weight of 304.3 g/mol. IUPAC name: 1-[3,5-bis(imidazol-1-ylmethyl)phenyl]imidazole. InChIKey: AUGVTOSADBOKFC-UHFFFAOYSA-N.
| Molecular formula | C17H16N6 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 1-[3,5-bis(imidazol-1-ylmethyl)phenyl]imidazole |
| InChIKey | AUGVTOSADBOKFC-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CC2=CC(=CC(=C2)N3C=CN=C3)CN4C=CN=C4 |
Computed by PubChem (NCBI)