CAS 225102-05-6 appears in our catalog under these names: Ethyl 2-(4-nitrophenoxy)butanoate, 95%, Ethyl 2-(4-nitrophenoxy)butanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Ethyl 2-(4-nitrophenoxy)butanoate (CAS 225102-05-6) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: ethyl 2-(4-nitrophenoxy)butanoate. InChIKey: NZSZBYKHXVLPBS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | ethyl 2-(4-nitrophenoxy)butanoate |
| InChIKey | NZSZBYKHXVLPBS-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)OCC)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)