CAS 22531-07-3 is the registry number for 3-(Propan-2-yl)-2,3-dihydro-1H-inden-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-propan-2-yl-2,3-dihydroinden-1-one (CAS 22531-07-3) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 3-propan-2-yl-2,3-dihydroinden-1-one. InChIKey: HGKUHNKHAFJFPW-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 3-propan-2-yl-2,3-dihydroinden-1-one |
| InChIKey | HGKUHNKHAFJFPW-UHFFFAOYSA-N |
| SMILES | CC(C)C1CC(=O)C2=CC=CC=C12 |
Computed by PubChem (NCBI)