Products 22535-49-5
CAS 22535-49-5 appears in our catalog under these names: 4-Benzoylphenyl Acrylate, >95.0%(HPLC), 4-Benzoylphenyl acrylate 98%, 4-Benzoylphenyl acrylate, 98%, 98%, 4-Benzoylphenyl acrylate, 96%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 250mg, 1g, 5g, 10g, 500g, 1000g.
(4-benzoylphenyl) prop-2-enoate (CAS 22535-49-5) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: (4-benzoylphenyl) prop-2-enoate. InChIKey: LTYBJDPMCPTGEE-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | (4-benzoylphenyl) prop-2-enoate |
| InChIKey | LTYBJDPMCPTGEE-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)