CAS 2253629-82-0 is the registry number for 1-(2-Methoxy-4,6-dimethylphenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-methoxy-4,6-dimethylphenyl)ethanamine;hydrochloride (CAS 2253629-82-0) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(2-methoxy-4,6-dimethylphenyl)ethanamine;hydrochloride. InChIKey: WQRYTWRSUBDFPC-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(2-methoxy-4,6-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | WQRYTWRSUBDFPC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)OC)C(C)N)C.Cl |
Computed by PubChem (NCBI)