Products 2253853-12-0
CAS 2253853-12-0 appears in our catalog under these names: tert-Butyl 8-bromo-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazine-4-carboxylate, 97%, 97%, tert-Butyl 8-bromo-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazine-4-carboxylate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
Tert-butyl 8-bromo-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate (CAS 2253853-12-0) is a chemical compound with the molecular formula C12H15BrN2O3 and a molecular weight of 315.16 g/mol. IUPAC name: tert-butyl 8-bromo-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate. InChIKey: CZIJKDHGEJCBJM-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O3 |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | tert-butyl 8-bromo-2,3-dihydropyrido[3,2-b][1,4]oxazine-4-carboxylate |
| InChIKey | CZIJKDHGEJCBJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C=CN=C21)Br |
Computed by PubChem (NCBI)