CAS 2253880-94-1 appears in our catalog under these names: Rac-(3r,5s)-4,4-difluoro-3,5-dimethylpiperidine hcl, 95%, rac-(3R,5S)-4,4-Difluoro-3,5-dimethylpiperidine hydrochloride, rel-(3R,5S)-4,4-Difluoro-3,5-dimethylpiperidine hydrochloride, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
(3S,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride (CAS 2253880-94-1) is a chemical compound with the molecular formula C7H14ClF2N and a molecular weight of 185.64 g/mol. IUPAC name: (3S,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride. InChIKey: GTJWXINJWOFKPF-KNCHESJLSA-N.
| Molecular formula | C7H14ClF2N |
|---|---|
| Molecular weight | 185.64 g/mol |
| IUPAC name | (3S,5R)-4,4-difluoro-3,5-dimethylpiperidine;hydrochloride |
| InChIKey | GTJWXINJWOFKPF-KNCHESJLSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1(F)F)C.Cl |
Computed by PubChem (NCBI)