Products 2253996-66-4
CAS 2253996-66-4 is the registry number for Antiparasitic agent-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-pyridin-3-ylprop-2-en-1-ol (CAS 2253996-66-4) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: 2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-pyridin-3-ylprop-2-en-1-ol. InChIKey: DIWIKSHBGLXAEL-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-(3-phenyl-1,2,4-oxadiazol-5-yl)-1-pyridin-3-ylprop-2-en-1-ol |
| InChIKey | DIWIKSHBGLXAEL-UHFFFAOYSA-N |
| SMILES | C=C(C1=NC(=NO1)C2=CC=CC=C2)C(C3=CN=CC=C3)O |
Computed by PubChem (NCBI)
Synonyms:
Antiparasitic agent-4, orb1689505