Products 2260-12-0
CAS 2260-12-0 is the registry number for 2-Amino-3-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-amino-3-phenylbutanoic acid (CAS 2260-12-0) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 2-amino-3-phenylbutanoic acid. InChIKey: IRZQDMYEJPNDEN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 2-amino-3-phenylbutanoic acid |
| InChIKey | IRZQDMYEJPNDEN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-3-phenylbutanoic acid, beta-Methylphenylalanine, (2R,3R)-2-Amino-3-phenyl-butyric acid, (2S,3R)-2-Amino-3-phenyl-butyric acid, D-Phenylalanine, -ba--methyl-, (-ba-S)- (9CI), (2R,3S)-2-Amino-3-phenyl-butyric acid, (2S,3S)-2-Amino-3-phenyl-butyric acid, b-Methyl-DL-phenylalanine, Phenylalanine, .beta.-methyl-, beta-Phenyl-alpha-aminobutyric acid