Products 2260917-68-6
CAS 2260917-68-6 is the registry number for tert-Butyl (4R,5R)-4-(aminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (4R,5R)-4-(aminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (CAS 2260917-68-6) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl (4R,5R)-4-(aminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: PFHYJLHCIFWOCF-RKDXNWHRSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl (4R,5R)-4-(aminomethyl)-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | PFHYJLHCIFWOCF-RKDXNWHRSA-N |
| SMILES | C[C@@H]1[C@H](N(C(O1)(C)C)C(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)