CAS 2260937-57-1 is the registry number for 8-Hydroxy-1,7-naphthyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-oxo-7H-1,7-naphthyridine-2-carboxylic acid (CAS 2260937-57-1) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 8-oxo-7H-1,7-naphthyridine-2-carboxylic acid. InChIKey: YELNYTRZMKWVFX-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 8-oxo-7H-1,7-naphthyridine-2-carboxylic acid |
| InChIKey | YELNYTRZMKWVFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C=CNC2=O)C(=O)O |
Computed by PubChem (NCBI)