Products 22615-00-5
CAS 22615-00-5 appears in our catalog under these names: 3-Bromoquinoline-1-oxide, 96%, 3-Bromoquinoline 1-oxide, 95-<97%, 3-Bromoquinoline 1-oxide, 95%, 3-Bromoquinoline 1-oxide 96%, 3-Bromoquinoline 1-oxide, 96%, 96%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 50g, 100g, 200g, 300g.
3-bromo-1-oxidoquinolin-1-ium (CAS 22615-00-5) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 3-bromo-1-oxidoquinolin-1-ium. InChIKey: LANTXZGXVINCPP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 3-bromo-1-oxidoquinolin-1-ium |
| InChIKey | LANTXZGXVINCPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=[N+]2[O-])Br |
Computed by PubChem (NCBI)