CAS 2411638-68-9 is the registry number for tert-Butyl (2,6-dioxopiperidin-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(2,6-dioxopiperidin-4-yl)carbamate (CAS 2411638-68-9) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: tert-butyl N-(2,6-dioxopiperidin-4-yl)carbamate. InChIKey: LKHVWZRCZFMROB-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O4 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | tert-butyl N-(2,6-dioxopiperidin-4-yl)carbamate |
| InChIKey | LKHVWZRCZFMROB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)NC(=O)C1 |
Computed by PubChem (NCBI)