CAS 2287347-64-0 is the registry number for tert-Butyl 2-[(2R)-3,6-dioxopiperazin-2-yl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 2-[(2R)-3,6-dioxopiperazin-2-yl]acetate (CAS 2287347-64-0) is a chemical compound with the molecular formula C10H16N2O4 and a molecular weight of 228.24 g/mol. IUPAC name: tert-butyl 2-[(2R)-3,6-dioxopiperazin-2-yl]acetate. InChIKey: LRNBCADDDXJIGH-ZCFIWIBFSA-N.
| Molecular formula | C10H16N2O4 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | tert-butyl 2-[(2R)-3,6-dioxopiperazin-2-yl]acetate |
| InChIKey | LRNBCADDDXJIGH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C(=O)NCC(=O)N1 |
Computed by PubChem (NCBI)