CAS 2270907-49-6 is the registry number for 3'-(2,2,2-Trifluoro-ethoxy)-biphenyl-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[3-(2,2,2-trifluoroethoxy)phenyl]benzaldehyde (CAS 2270907-49-6) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: 4-[3-(2,2,2-trifluoroethoxy)phenyl]benzaldehyde. InChIKey: ZXJRROYRWMHYQK-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O2 |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | 4-[3-(2,2,2-trifluoroethoxy)phenyl]benzaldehyde |
| InChIKey | ZXJRROYRWMHYQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)