Products 2270908-06-8
CAS 2270908-06-8 is the registry number for 2-Ethoxy-5-hydroxy-n,n-dimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-ethoxy-5-hydroxy-N,N-dimethylbenzamide (CAS 2270908-06-8) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 2-ethoxy-5-hydroxy-N,N-dimethylbenzamide. InChIKey: BALPKHXPDFLXAU-UHFFFAOYSA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-ethoxy-5-hydroxy-N,N-dimethylbenzamide |
| InChIKey | BALPKHXPDFLXAU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)O)C(=O)N(C)C |
Computed by PubChem (NCBI)