CAS 2270909-21-0 is the registry number for 2-[4-(4-Formyl-phenyl)-pyrazol-1-yl]-n,n-dimethyl-acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(4-formylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide (CAS 2270909-21-0) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 2-[4-(4-formylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide. InChIKey: XJQAZJMKIUUBLH-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 2-[4-(4-formylphenyl)pyrazol-1-yl]-N,N-dimethylacetamide |
| InChIKey | XJQAZJMKIUUBLH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)CN1C=C(C=N1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)