Products 22711-92-8

CAS 22711-92-8 is the registry number for 1,3-Dimethyl 2,2-bis(2-cyanoethyl)propanedioate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Dimethyl 2,2-bis(2-cyanoethyl)propanedioate (CAS 22711-92-8) is a chemical compound with the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. IUPAC name: dimethyl 2,2-bis(2-cyanoethyl)propanedioate. InChIKey: UALIRWVABCZAEH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O4
Molecular weight238.24 g/mol
IUPAC namedimethyl 2,2-bis(2-cyanoethyl)propanedioate
InChIKeyUALIRWVABCZAEH-UHFFFAOYSA-N
SMILESCOC(=O)C(CCC#N)(CCC#N)C(=O)OC

Computed by PubChem (NCBI)