Products 2275668-65-8
CAS 2275668-65-8 is the registry number for 2-Methoxy-α-methyl-α-(trifluoromethyl)-3-pyridinemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,1,1-trifluoro-2-(2-methoxy-3-pyridinyl)propan-2-ol (CAS 2275668-65-8) is a chemical compound with the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. IUPAC name: 1,1,1-trifluoro-2-(2-methoxy-3-pyridinyl)propan-2-ol. InChIKey: IZPVTLQWNPMRQI-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO2 |
|---|---|
| Molecular weight | 221.18 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-(2-methoxy-3-pyridinyl)propan-2-ol |
| InChIKey | IZPVTLQWNPMRQI-UHFFFAOYSA-N |
| SMILES | CC(C1=C(N=CC=C1)OC)(C(F)(F)F)O |
Computed by PubChem (NCBI)