CAS 22768-95-2 is the registry number for (-)-Eleutherin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,3R)-9-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione (CAS 22768-95-2) is a chemical compound with the molecular formula C16H16O4 and a molecular weight of 272.29 g/mol. IUPAC name: (1S,3R)-9-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione. InChIKey: IAJIIJBMBCZPSW-BDAKNGLRSA-N.
| Molecular formula | C16H16O4 |
|---|---|
| Molecular weight | 272.29 g/mol |
| IUPAC name | (1S,3R)-9-methoxy-1,3-dimethyl-3,4-dihydro-1H-benzo[g]isochromene-5,10-dione |
| InChIKey | IAJIIJBMBCZPSW-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC2=C([C@@H](O1)C)C(=O)C3=C(C2=O)C=CC=C3OC |
Computed by PubChem (NCBI)