Products 227783-07-5

CAS 227783-07-5 is the registry number for (1S,3R)-3-(Methoxycarbonyl)cyclohexanecarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 5g, 10g, 100mg.

Structural formula: {0} (CAS {1})

Cis-(1S,3R)-3-methoxycarbonylcyclohexane-1-carboxylic acid (CAS 227783-07-5) is a chemical compound with the molecular formula C9H14O4 and a molecular weight of 186.20 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: PODOUIALODEQFA-NKWVEPMBSA-N.

Identity
Molecular formulaC9H14O4
Molecular weight186.20 g/mol
IUPAC namecis-(1S,3R)-3-methoxycarbonylcyclohexane-1-carboxylic acid
InChIKeyPODOUIALODEQFA-NKWVEPMBSA-N
SMILESCOC(=O)[C@@H]1CCC[C@@H](C1)C(=O)O

Computed by PubChem (NCBI)