CAS 22802-73-9 appears in our catalog under these names: 5-Amino-2-methoxy-n,n-dimethylbenzamide, 95%, 5-Amino-2-methoxy-N,N-dimethylbenzamide, 95%, 95%, 5-Amino-2-methoxy-N,N-dimethylbenzamide, 95+%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 1g, 5g, 250mg.
5-amino-2-methoxy-N,N-dimethylbenzamide (CAS 22802-73-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-amino-2-methoxy-N,N-dimethylbenzamide. InChIKey: AJVBTKWDYGBNGY-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-amino-2-methoxy-N,N-dimethylbenzamide |
| InChIKey | AJVBTKWDYGBNGY-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)N)OC |
Computed by PubChem (NCBI)