CAS 2281013-27-0 is the registry number for tert-Butyl 2-(hydroxymethyl)-5,7-dihydro-6H-pyrrolo[3,4-b]pyridine-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-(hydroxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate (CAS 2281013-27-0) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: tert-butyl 2-(hydroxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate. InChIKey: VBJPVUJTOGNIBL-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | tert-butyl 2-(hydroxymethyl)-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxylate |
| InChIKey | VBJPVUJTOGNIBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)N=C(C=C2)CO |
Computed by PubChem (NCBI)