CAS 2282727-67-5 is the registry number for Ethyl 6-chloro-8-methylchromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2282727-67-5) is a chemical compound with the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. IUPAC name: ethyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: ZTDRRPVDLAJCEW-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | ethyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | ZTDRRPVDLAJCEW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C(=CC(=C2)Cl)C)OC1 |
Computed by PubChem (NCBI)