Products 1356465-54-7
CAS 1356465-54-7 is the registry number for 2-([1-(4-Chlorophenyl)cyclobutyl]methoxy)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[[1-(4-chlorophenyl)cyclobutyl]methoxy]acetic acid (CAS 1356465-54-7) is a chemical compound with the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. IUPAC name: 2-[[1-(4-chlorophenyl)cyclobutyl]methoxy]acetic acid. InChIKey: FHMWGXCWCXPWSA-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-[[1-(4-chlorophenyl)cyclobutyl]methoxy]acetic acid |
| InChIKey | FHMWGXCWCXPWSA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(COCC(=O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)