CAS 2282751-80-6 is the registry number for Methyl 6-chloro-5,7-dimethylchromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-5,7-dimethyl-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2282751-80-6) is a chemical compound with the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. IUPAC name: methyl 6-chloro-5,7-dimethyl-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: DDQPWFCQHZQYFI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | methyl 6-chloro-5,7-dimethyl-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | DDQPWFCQHZQYFI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC(CO2)C(=O)OC)C(=C1Cl)C |
Computed by PubChem (NCBI)