CAS 36600-72-3 appears in our catalog under these names: 2-(4-Chlorobenzyl)acetoacetic acid ethyl ester, 95%, 2-(4-Chlorobenzyl)acetoacetic acid ethyl ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
Ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate (CAS 36600-72-3) is a chemical compound with the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. IUPAC name: ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate. InChIKey: HQZNZKQSSZWNEB-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | ethyl 2-[(4-chlorophenyl)methyl]-3-oxobutanoate |
| InChIKey | HQZNZKQSSZWNEB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)Cl)C(=O)C |
Computed by PubChem (NCBI)