Products 2287236-95-5
CAS 2287236-95-5 is the registry number for rac-tert-Butyl (4aR,8aR)-4a-(hydroxymethyl)-decahydroquinoline-1-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl (4aS,8aS)-4a-(hydroxymethyl)-2,3,4,5,6,7,8,8a-octahydroquinoline-1-carboxylate (CAS 2287236-95-5) is a chemical compound with the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. IUPAC name: tert-butyl (4aS,8aS)-4a-(hydroxymethyl)-2,3,4,5,6,7,8,8a-octahydroquinoline-1-carboxylate. InChIKey: HUNBQHSQDCOVFO-SWLSCSKDSA-N.
| Molecular formula | C15H27NO3 |
|---|---|
| Molecular weight | 269.38 g/mol |
| IUPAC name | tert-butyl (4aS,8aS)-4a-(hydroxymethyl)-2,3,4,5,6,7,8,8a-octahydroquinoline-1-carboxylate |
| InChIKey | HUNBQHSQDCOVFO-SWLSCSKDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]2([C@@H]1CCCC2)CO |
Computed by PubChem (NCBI)